C17H26N6O — CID 143575181
cyclohexanol;4-[1-methyl-5-(prop-1-en-2-ylamino)pyrazol-4-yl]pyrimidin-2-amine (PubChem CID 143575181) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is cyclohexanol;4-[1-methyl-5-(prop-1-en-2-ylamino)pyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | cyclohexanol;4-[1-methyl-5-(prop-1-en-2-ylamino)pyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143575181 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | cyclohexanol;4-[1-methyl-5-(prop-1-en-2-ylamino)pyrazol-4-yl]pyrimidin-2-amine |
| SMILES | C=C(C)Nc1c(-c2ccnc(N)n2)cnn1C.OC1CCCCC1 |
| InChI | InChI=1S/C11H14N6.C6H12O/c1-7(2)15-10-8(6-14-17(10)3)9-4-5-13-11(12)16-9;7-6-4-2-1-3-5-6/h4-6,15H,1H2,2-3H3,(H2,12,13,16);6-7H,1-5H2 |
| InChIKey | KHTXPDFLKWGHHX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |