About 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone
3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone (PubChem CID 143575407) has the molecular formula C22H23NO2
and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone.
Molecular Properties
| Compound Name | 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone |
| PubChem CID | 143575407 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone |
| SMILES | CC(=O)c1ccc(-c2ccccc2)cc1.CCc1ccc(O)cc1N |
| InChI | InChI=1S/C14H12O.C8H11NO/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13;1-2-6-3-4-7(10)5-8(6)9/h2-10H,1H3;3-5,10H,2,9H2,1H3 |
| InChIKey | DLYKGFCHDPYMTP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone?
The IUPAC name of 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone (CID 143575407) is 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone.
What is the SMILES notation for 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone?
The canonical SMILES for 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone is CC(=O)c1ccc(-c2ccccc2)cc1.CCc1ccc(O)cc1N.
What is the InChIKey of 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone?
The InChIKey is DLYKGFCHDPYMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.C8H11NO/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13;1-2-6-3-4-7(10)5-8(6)9/h2-10H,1H3;3-5,10H,2,9H2,1H3.
What are the key properties of 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone?
3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone has a molecular weight of 333.43 g/mol, XLogP of 5.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-ethylphenol;1-(4-phenylphenyl)ethanone is sourced from PubChem (CID 143575407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).