C11H17F3N2O2 — CID 143575663
ethyl 3-amino-4,4,4-trifluoro-2-(2-methylpropyliminomethyl)but-2-enoate (PubChem CID 143575663) has the molecular formula C11H17F3N2O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is ethyl 3-amino-4,4,4-trifluoro-2-(2-methylpropyliminomethyl)but-2-enoate.
| Compound Name | ethyl 3-amino-4,4,4-trifluoro-2-(2-methylpropyliminomethyl)but-2-enoate |
|---|---|
| PubChem CID | 143575663 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | ethyl 3-amino-4,4,4-trifluoro-2-(2-methylpropyliminomethyl)but-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CC(C)C)=C(N)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O2/c1-4-18-10(17)8(6-16-5-7(2)3)9(15)11(12,13)14/h6-7H,4-5,15H2,1-3H3/b9-8?,16-6+ |
| InChIKey | WGUKMHVDRBUOMT-ALVBDMDPSA-N |
| XLogP | 2.05 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|