C19H22F3N3O3 — CID 143576985
2-[(12S)-13-oxo-7-propan-2-yl-14-(2,2,2-trifluoroethyl)-4,5,14-triazatricyclo[7.6.0.02,6]pentadeca-1,3,6,8-tetraen-12-yl]acetic acid (PubChem CID 143576985) has the molecular formula C19H22F3N3O3 and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-[(12S)-13-oxo-7-propan-2-yl-14-(2,2,2-trifluoroethyl)-4,5,14-triazatricyclo[7.6.0.02,6]pentadeca-1,3,6,8-tetraen-12-yl]acetic acid.
| Compound Name | 2-[(12S)-13-oxo-7-propan-2-yl-14-(2,2,2-trifluoroethyl)-4,5,14-triazatricyclo[7.6.0.02,6]pentadeca-1,3,6,8-tetraen-12-yl]acetic acid |
|---|---|
| PubChem CID | 143576985 |
| Molecular Formula | C19H22F3N3O3 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[(12S)-13-oxo-7-propan-2-yl-14-(2,2,2-trifluoroethyl)-4,5,14-triazatricyclo[7.6.0.02,6]pentadeca-1,3,6,8-tetraen-12-yl]acetic acid |
| SMILES | CC(C)c1cc2c(c3cn[nH]c13)CN(CC(F)(F)F)C(=O)[C@H](CC(=O)O)CC2 |
| InChI | InChI=1S/C19H22F3N3O3/c1-10(2)13-5-11-3-4-12(6-16(26)27)18(28)25(9-19(20,21)22)8-15(11)14-7-23-24-17(13)14/h5,7,10,12H,3-4,6,8-9H2,1-2H3,(H,23,24)(H,26,27)/t12-/m0/s1 |
| InChIKey | UYSICFPJVFPAFH-LBPRGKRZSA-N |
| XLogP | 3.61 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |