C24H26N2O5 — CID 143580526
(4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-3,6-dimethyl-1-methylidene-12-oxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 143580526) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-3,6-dimethyl-1-methylidene-12-oxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-3,6-dimethyl-1-methylidene-12-oxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 143580526 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-3,6-dimethyl-1-methylidene-12-oxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | C=C1C(C(N)=O)=C(C)C(N(C)C)[C@@H]2Cc3c(c(O)c4c(O)cccc4c3C)C(=O)[C@]12O |
| InChI | InChI=1S/C24H26N2O5/c1-10-13-7-6-8-16(27)18(13)21(28)19-14(10)9-15-20(26(4)5)11(2)17(23(25)30)12(3)24(15,31)22(19)29/h6-8,15,20,27-28,31H,3,9H2,1-2,4-5H3,(H2,25,30)/t15-,20?,24-/m0/s1 |
| InChIKey | MMCMRSQZCHQMQL-QLODVIIJSA-N |
| XLogP | 1.95 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |