C23H26ClN3O7 — CID 157243623
(4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;methane (PubChem CID 157243623) has the molecular formula C23H26ClN3O7 and a molecular weight of 491.93 g/mol. Its IUPAC name is (4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;methane.
| Compound Name | (4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;methane |
|---|---|
| PubChem CID | 157243623 |
| Molecular Formula | C23H26ClN3O7 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;methane |
| SMILES | C.CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)c3c(cc4c(Cl)cc(CN)c(O)c4c3O)C[C@@H]12 |
| InChI | InChI=1S/C22H22ClN3O7.CH4/c1-26(2)15-10-4-7-3-9-11(23)5-8(6-24)16(27)13(9)17(28)12(7)19(30)22(10,33)20(31)14(18(15)29)21(25)32;/h3,5,10,15,27-28,31,33H,4,6,24H2,1-2H3,(H2,25,32);1H4/t10-,15-,22-;/m0./s1 |
| InChIKey | FHJLVTUWMFGNHK-NKTSYYOZSA-N |
| XLogP | 0.90 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|