C25H27ClN2O7 — CID 58648230
(4aS,12aR)-7-chloro-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 58648230) has the molecular formula C25H27ClN2O7 and a molecular weight of 502.95 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648230 |
| Molecular Formula | C25H27ClN2O7 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (4aS,12aR)-7-chloro-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)(C)CNCc1cc(Cl)c2cc3c(c(O)c2c1O)C(=O)[C@]1(O)C(O)=C(C(N)=O)C(=O)C[C@@H]1C3 |
| InChI | InChI=1S/C25H27ClN2O7/c1-24(2,3)9-28-8-11-6-14(26)13-5-10-4-12-7-15(29)18(23(27)34)22(33)25(12,35)21(32)16(10)20(31)17(13)19(11)30/h5-6,12,28,30-31,33,35H,4,7-9H2,1-3H3,(H2,27,34)/t12-,25-/m0/s1 |
| InChIKey | PWXLSIWKFNFETN-VDBVYFBLSA-N |
| XLogP | 2.40 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|