C24H23NO7 — CID 177229739
7-cyclopentyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 177229739) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is 7-cyclopentyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-cyclopentyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229739 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 7-cyclopentyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)c3c(cc4c(C5CCCC5)ccc(O)c4c3O)CC2CC1=O |
| InChI | InChI=1S/C24H23NO7/c25-23(31)19-16(27)9-12-7-11-8-14-13(10-3-1-2-4-10)5-6-15(26)18(14)20(28)17(11)21(29)24(12,32)22(19)30/h5-6,8,10,12,26,28,30,32H,1-4,7,9H2,(H2,25,31) |
| InChIKey | VANWLZNRHCUREQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|