C19H14ClNO7 — CID 90746263
(4aS,12aR)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 90746263) has the molecular formula C19H14ClNO7 and a molecular weight of 403.77 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90746263 |
| Molecular Formula | C19H14ClNO7 |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (4aS,12aR)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2Cc3cc4c(Cl)ccc(O)c4c(O)c3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C19H14ClNO7/c20-9-1-2-10(22)13-8(9)4-6-3-7-5-11(23)14(18(21)27)17(26)19(7,28)16(25)12(6)15(13)24/h1-2,4,7,14,22,24,28H,3,5H2,(H2,21,27)/t7-,14?,19-/m0/s1 |
| InChIKey | IZQJNYJNUISZDF-NPJMWECXSA-N |
| XLogP | 0.63 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|