C20H17ClN2O7 — CID 91254674
(4aS,12aR)-9-(aminomethyl)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 91254674) has the molecular formula C20H17ClN2O7 and a molecular weight of 432.82 g/mol. Its IUPAC name is (4aS,12aR)-9-(aminomethyl)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-9-(aminomethyl)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91254674 |
| Molecular Formula | C20H17ClN2O7 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (4aS,12aR)-9-(aminomethyl)-7-chloro-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | NCc1cc(Cl)c2cc3c(c(O)c2c1O)C(=O)[C@]1(O)C(=O)C(C(N)=O)C(=O)C[C@@H]1C3 |
| InChI | InChI=1S/C20H17ClN2O7/c21-10-3-7(5-22)15(25)13-9(10)2-6-1-8-4-11(24)14(19(23)29)18(28)20(8,30)17(27)12(6)16(13)26/h2-3,8,14,25-26,30H,1,4-5,22H2,(H2,23,29)/t8-,14?,20-/m0/s1 |
| InChIKey | RYBMFJLTRMWLPO-OARPCGPHSA-N |
| XLogP | 0.09 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|