C27H32N2O8 — CID 90944796
(4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-7-(methoxymethyl)-9-(2-methylpropyl)-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 90944796) has the molecular formula C27H32N2O8 and a molecular weight of 512.56 g/mol. Its IUPAC name is (4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-7-(methoxymethyl)-9-(2-methylpropyl)-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-7-(methoxymethyl)-9-(2-methylpropyl)-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90944796 |
| Molecular Formula | C27H32N2O8 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-7-(methoxymethyl)-9-(2-methylpropyl)-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | COCc1cc(CC(C)C)c(O)c2c(O)c3c(cc12)C[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]1(O)C3=O |
| InChI | InChI=1S/C27H32N2O8/c1-11(2)6-13-7-14(10-37-5)15-8-12-9-16-20(29(3)4)23(32)19(26(28)35)25(34)27(16,36)24(33)17(12)22(31)18(15)21(13)30/h7-8,11,16,19-20,30-31,36H,6,9-10H2,1-5H3,(H2,28,35)/t16-,19?,20-,27-/m0/s1 |
| InChIKey | XFHVGJZWRXTMKL-HVYBQONWSA-N |
| XLogP | 0.87 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|