C26H25N3O7 — CID 91059899
(15S,16S,20R)-16-(dimethylamino)-2,20-dihydroxy-6-(2-methylprop-1-enyl)-17,19,21-trioxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1(13),2,4(8),6,9,11-hexaene-18-carboxamide (PubChem CID 91059899) has the molecular formula C26H25N3O7 and a molecular weight of 491.50 g/mol. Its IUPAC name is (15S,16S,20R)-16-(dimethylamino)-2,20-dihydroxy-6-(2-methylprop-1-enyl)-17,19,21-trioxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1(13),2,4(8),6,9,11-hexaene-18-carboxamide.
| Compound Name | (15S,16S,20R)-16-(dimethylamino)-2,20-dihydroxy-6-(2-methylprop-1-enyl)-17,19,21-trioxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1(13),2,4(8),6,9,11-hexaene-18-carboxamide |
|---|---|
| PubChem CID | 91059899 |
| Molecular Formula | C26H25N3O7 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (15S,16S,20R)-16-(dimethylamino)-2,20-dihydroxy-6-(2-methylprop-1-enyl)-17,19,21-trioxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1(13),2,4(8),6,9,11-hexaene-18-carboxamide |
| SMILES | CC(C)=Cc1nc2ccc3cc4c(c(O)c3c2o1)C(=O)[C@]1(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]1C4 |
| InChI | InChI=1S/C26H25N3O7/c1-10(2)7-15-28-14-6-5-11-8-12-9-13-19(29(3)4)21(31)18(25(27)34)24(33)26(13,35)23(32)17(12)20(30)16(11)22(14)36-15/h5-8,13,18-19,30,35H,9H2,1-4H3,(H2,27,34)/t13-,18?,19-,26-/m0/s1 |
| InChIKey | FIQQJXCELFRBOZ-DVQZMXRZSA-N |
| XLogP | 1.38 |
| TPSA | 164.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|