C31H32N4O7 — CID 91058667
(13R,15S,16S,20S)-10,16-bis(dimethylamino)-20-hydroxy-6-(4-methylphenyl)-2,17,19,21-tetraoxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-3,6,8,10-tetraene-18-carboxamide (PubChem CID 91058667) has the molecular formula C31H32N4O7 and a molecular weight of 572.62 g/mol. Its IUPAC name is (13R,15S,16S,20S)-10,16-bis(dimethylamino)-20-hydroxy-6-(4-methylphenyl)-2,17,19,21-tetraoxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-3,6,8,10-tetraene-18-carboxamide.
| Compound Name | (13R,15S,16S,20S)-10,16-bis(dimethylamino)-20-hydroxy-6-(4-methylphenyl)-2,17,19,21-tetraoxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-3,6,8,10-tetraene-18-carboxamide |
|---|---|
| PubChem CID | 91058667 |
| Molecular Formula | C31H32N4O7 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (13R,15S,16S,20S)-10,16-bis(dimethylamino)-20-hydroxy-6-(4-methylphenyl)-2,17,19,21-tetraoxo-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-3,6,8,10-tetraene-18-carboxamide |
| SMILES | Cc1ccc(-c2nc3cc(N(C)C)c4c(c3o2)C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]2C4)cc1 |
| InChI | InChI=1S/C31H32N4O7/c1-13-6-8-14(9-7-13)30-33-18-12-19(34(2)3)16-10-15-11-17-23(35(4)5)25(37)22(29(32)40)28(39)31(17,41)27(38)20(15)24(36)21(16)26(18)42-30/h6-9,12,15,17,20,22-23,41H,10-11H2,1-5H3,(H2,32,40)/t15-,17-,20?,22?,23-,31-/m0/s1 |
| InChIKey | VZYYDTCWTXPTKL-GHYIZDODSA-N |
| XLogP | 1.34 |
| TPSA | 164.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|