C23H18N4O8 — CID 136652218
(4aS,12aR)-10,11,12a-trihydroxy-4-(hydroxyamino)-1,3,12-trioxo-7-pyrazin-2-yl-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 136652218) has the molecular formula C23H18N4O8 and a molecular weight of 478.42 g/mol. Its IUPAC name is (4aS,12aR)-10,11,12a-trihydroxy-4-(hydroxyamino)-1,3,12-trioxo-7-pyrazin-2-yl-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-10,11,12a-trihydroxy-4-(hydroxyamino)-1,3,12-trioxo-7-pyrazin-2-yl-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 136652218 |
| Molecular Formula | C23H18N4O8 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (4aS,12aR)-10,11,12a-trihydroxy-4-(hydroxyamino)-1,3,12-trioxo-7-pyrazin-2-yl-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C(NO)[C@@H]2Cc3cc4c(-c5cnccn5)ccc(O)c4c(O)c3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C23H18N4O8/c24-22(33)16-19(30)17(27-35)11-6-8-5-10-9(12-7-25-3-4-26-12)1-2-13(28)15(10)18(29)14(8)20(31)23(11,34)21(16)32/h1-5,7,11,16-17,27-29,34-35H,6H2,(H2,24,33)/t11-,16?,17?,23-/m0/s1 |
| InChIKey | RBNUKGUPYZIJRF-LXVQYGTOSA-N |
| XLogP | -0.61 |
| TPSA | 213.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|