C22H22ClN3O7 — CID 91343594
(4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 91343594) has the molecular formula C22H22ClN3O7 and a molecular weight of 475.89 g/mol. Its IUPAC name is (4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91343594 |
| Molecular Formula | C22H22ClN3O7 |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | (4S,4aS,12aR)-9-(aminomethyl)-7-chloro-4-(dimethylamino)-10,11,12a-trihydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)c3c(cc4c(Cl)cc(CN)c(O)c4c3O)C[C@@H]12 |
| InChI | InChI=1S/C22H22ClN3O7/c1-26(2)15-10-4-7-3-9-11(23)5-8(6-24)16(27)13(9)17(28)12(7)19(30)22(10,33)20(31)14(18(15)29)21(25)32/h3,5,10,14-15,27-28,33H,4,6,24H2,1-2H3,(H2,25,32)/t10-,14?,15-,22-/m0/s1 |
| InChIKey | KHBJNCVIMOCBAG-VFNLIZJFSA-N |
| XLogP | -0.37 |
| TPSA | 184.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|