C23H22N2O9 — CID 91263289
(4aR,5R,12aR)-9-amino-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-5-(2-oxobutyl)-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 91263289) has the molecular formula C23H22N2O9 and a molecular weight of 470.43 g/mol. Its IUPAC name is (4aR,5R,12aR)-9-amino-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-5-(2-oxobutyl)-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5R,12aR)-9-amino-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-5-(2-oxobutyl)-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91263289 |
| Molecular Formula | C23H22N2O9 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (4aR,5R,12aR)-9-amino-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-5-(2-oxobutyl)-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CCC(=O)C[C@H]1c2c(c(O)c3c(O)c(N)ccc3c2O)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(=O)C[C@H]12 |
| InChI | InChI=1S/C23H22N2O9/c1-2-7(26)5-9-10-6-12(27)15(22(25)33)20(31)23(10,34)21(32)16-13(9)17(28)8-3-4-11(24)18(29)14(8)19(16)30/h3-4,9-10,15,28-30,34H,2,5-6,24H2,1H3,(H2,25,33)/t9-,10-,15?,23-/m1/s1 |
| InChIKey | NXRQCCJZWMFWTO-KRSDPXJOSA-N |
| XLogP | 0.18 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|