C20H15NO10 — CID 91103384
[(4aR,5R,12aR)-2-carbamoyl-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracen-5-yl] formate (PubChem CID 91103384) has the molecular formula C20H15NO10 and a molecular weight of 429.34 g/mol. Its IUPAC name is [(4aR,5R,12aR)-2-carbamoyl-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracen-5-yl] formate.
| Compound Name | [(4aR,5R,12aR)-2-carbamoyl-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracen-5-yl] formate |
|---|---|
| PubChem CID | 91103384 |
| Molecular Formula | C20H15NO10 |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | [(4aR,5R,12aR)-2-carbamoyl-6,10,11,12a-tetrahydroxy-1,3,12-trioxo-4a,5-dihydro-4H-tetracen-5-yl] formate |
| SMILES | NC(=O)C1C(=O)C[C@@H]2[C@@H](OC=O)c3c(c(O)c4c(O)cccc4c3O)C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C20H15NO10/c21-19(29)11-9(24)4-7-16(31-5-22)12-13(18(28)20(7,30)17(11)27)15(26)10-6(14(12)25)2-1-3-8(10)23/h1-3,5,7,11,16,23,25-26,30H,4H2,(H2,21,29)/t7-,11?,16-,20-/m1/s1 |
| InChIKey | QDOWPIUBMSLZOJ-PAZLXWTESA-N |
| XLogP | -0.64 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|