C22H18F3NO7 — CID 177229308
(4aS,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(1,1,1-trifluoropropan-2-yl)-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 177229308) has the molecular formula C22H18F3NO7 and a molecular weight of 465.38 g/mol. Its IUPAC name is (4aS,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(1,1,1-trifluoropropan-2-yl)-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(1,1,1-trifluoropropan-2-yl)-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229308 |
| Molecular Formula | C22H18F3NO7 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | (4aS,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(1,1,1-trifluoropropan-2-yl)-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CC(c1ccc(O)c2c(O)c3c(cc12)C[C@H]1CC(=O)C(C(N)=O)=C(O)[C@@]1(O)C3=O)C(F)(F)F |
| InChI | InChI=1S/C22H18F3NO7/c1-7(22(23,24)25)10-2-3-12(27)15-11(10)5-8-4-9-6-13(28)16(20(26)32)19(31)21(9,33)18(30)14(8)17(15)29/h2-3,5,7,9,27,29,31,33H,4,6H2,1H3,(H2,26,32)/t7?,9-,21-/m0/s1 |
| InChIKey | AEMWGAQLYRKNPA-MKKCUWESSA-N |
| XLogP | 2.27 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|