C23H19N3O7S — CID 177229347
4-amino-1,10,11,12a-tetrahydroxy-7-(3-methyl-1,2-thiazol-5-yl)-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 177229347) has the molecular formula C23H19N3O7S and a molecular weight of 481.49 g/mol. Its IUPAC name is 4-amino-1,10,11,12a-tetrahydroxy-7-(3-methyl-1,2-thiazol-5-yl)-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-amino-1,10,11,12a-tetrahydroxy-7-(3-methyl-1,2-thiazol-5-yl)-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229347 |
| Molecular Formula | C23H19N3O7S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 4-amino-1,10,11,12a-tetrahydroxy-7-(3-methyl-1,2-thiazol-5-yl)-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1cc(-c2ccc(O)c3c(O)c4c(cc23)CC2C(N)C(=O)C(C(N)=O)=C(O)C2(O)C4=O)sn1 |
| InChI | InChI=1S/C23H19N3O7S/c1-7-4-13(34-26-7)9-2-3-12(27)15-10(9)5-8-6-11-17(24)19(29)16(22(25)32)21(31)23(11,33)20(30)14(8)18(15)28/h2-5,11,17,27-28,31,33H,6,24H2,1H3,(H2,25,32) |
| InChIKey | GFFXFDQIADHZDR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 197.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|