C24H25N3O8 — CID 54725931
9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 54725931) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is 9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54725931 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc2c(C)c3c(c(O)c2c1O)C(=O)C1(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C1C3 |
| InChI | InChI=1S/C24H25N3O8/c1-8-10-5-6-13(26-9(2)28)18(29)14(10)19(30)15-11(8)7-12-17(27(3)4)20(31)16(23(25)34)22(33)24(12,35)21(15)32/h5-6,12,17,29-30,33,35H,7H2,1-4H3,(H2,25,34)(H,26,28) |
| InChIKey | HBVHABXJJFVFDO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|