C11H13IN2OS — CID 143582525
5-methyl-3-[(methylidene-λ3-iodanyl)amino]-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 143582525) has the molecular formula C11H13IN2OS and a molecular weight of 348.21 g/mol. Its IUPAC name is 5-methyl-3-[(methylidene-λ3-iodanyl)amino]-2,3-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | 5-methyl-3-[(methylidene-λ3-iodanyl)amino]-2,3-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 143582525 |
| Molecular Formula | C11H13IN2OS |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 5-methyl-3-[(methylidene-λ3-iodanyl)amino]-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | C=INC1CSc2ccccc2N(C)C1=O |
| InChI | InChI=1S/C11H13IN2OS/c1-12-13-8-7-16-10-6-4-3-5-9(10)14(2)11(8)15/h3-6,8,13H,1,7H2,2H3 |
| InChIKey | WSRSJEPEASCLMZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|