About 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane
3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane (PubChem CID 143582743) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane.
Molecular Properties
| Compound Name | 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane |
| PubChem CID | 143582743 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane |
| SMILES | C.C1NCC2CC12.CN(C)C |
| InChI | InChI=1S/C5H9N.C3H9N.CH4/c1-4-2-6-3-5(1)4;1-4(2)3;/h4-6H,1-3H2;1-3H3;1H4 |
| InChIKey | KXANKQMDDFZHJT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane?
The IUPAC name of 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane (CID 143582743) is 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane.
What is the SMILES notation for 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane?
The canonical SMILES for 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane is C.C1NCC2CC12.CN(C)C.
What is the InChIKey of 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane?
The InChIKey is KXANKQMDDFZHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N.C3H9N.CH4/c1-4-2-6-3-5(1)4;1-4(2)3;/h4-6H,1-3H2;1-3H3;1H4.
What are the key properties of 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane?
3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane has a molecular weight of 158.29 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azabicyclo[3.1.0]hexane;N,N-dimethylmethanamine;methane is sourced from PubChem (CID 143582743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).