C21H24FIN4O2 — CID 143584503
2-[2-(4-fluorocyclohexa-2,4-dien-1-yl)ethylamino]-N-[3-(4-iodo-1-methylpyrazol-5-yl)-4-methoxyphenyl]acetamide (PubChem CID 143584503) has the molecular formula C21H24FIN4O2 and a molecular weight of 510.35 g/mol. Its IUPAC name is 2-[2-(4-fluorocyclohexa-2,4-dien-1-yl)ethylamino]-N-[3-(4-iodo-1-methylpyrazol-5-yl)-4-methoxyphenyl]acetamide.
| Compound Name | 2-[2-(4-fluorocyclohexa-2,4-dien-1-yl)ethylamino]-N-[3-(4-iodo-1-methylpyrazol-5-yl)-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 143584503 |
| Molecular Formula | C21H24FIN4O2 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 2-[2-(4-fluorocyclohexa-2,4-dien-1-yl)ethylamino]-N-[3-(4-iodo-1-methylpyrazol-5-yl)-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(=O)CNCCC2C=CC(F)=CC2)cc1-c1c(I)cnn1C |
| InChI | InChI=1S/C21H24FIN4O2/c1-27-21(18(23)12-25-27)17-11-16(7-8-19(17)29-2)26-20(28)13-24-10-9-14-3-5-15(22)6-4-14/h3,5-8,11-12,14,24H,4,9-10,13H2,1-2H3,(H,26,28) |
| InChIKey | VSNIQQMOJNIRAS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|