C13H20FNO — CID 143587729
N-[(2Z,4Z)-3-fluoro-8-methyl-6-methylidenenona-2,4-dien-2-yl]acetamide (PubChem CID 143587729) has the molecular formula C13H20FNO and a molecular weight of 225.31 g/mol. Its IUPAC name is N-[(2Z,4Z)-3-fluoro-8-methyl-6-methylidenenona-2,4-dien-2-yl]acetamide.
| Compound Name | N-[(2Z,4Z)-3-fluoro-8-methyl-6-methylidenenona-2,4-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 143587729 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-[(2Z,4Z)-3-fluoro-8-methyl-6-methylidenenona-2,4-dien-2-yl]acetamide |
| SMILES | C=C(/C=C\C(F)=C(/C)NC(C)=O)CC(C)C |
| InChI | InChI=1S/C13H20FNO/c1-9(2)8-10(3)6-7-13(14)11(4)15-12(5)16/h6-7,9H,3,8H2,1-2,4-5H3,(H,15,16)/b7-6-,13-11- |
| InChIKey | HORYPUGSARLCMS-FICPNTFISA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|