C9H16O2 — CID 143588141
3-ethyl-3,5,6-trimethyl-2H-1,4-dioxine (PubChem CID 143588141) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-ethyl-3,5,6-trimethyl-2H-1,4-dioxine.
| Compound Name | 3-ethyl-3,5,6-trimethyl-2H-1,4-dioxine |
|---|---|
| PubChem CID | 143588141 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-ethyl-3,5,6-trimethyl-2H-1,4-dioxine |
| SMILES | CCC1(C)COC(C)=C(C)O1 |
| InChI | InChI=1S/C9H16O2/c1-5-9(4)6-10-7(2)8(3)11-9/h5-6H2,1-4H3 |
| InChIKey | GQEXCGIBHLQCKH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |