C10H18O2 — CID 122631119
2,2,3,3,5,6-hexamethyl-1,4-dioxine (PubChem CID 122631119) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2,2,3,3,5,6-hexamethyl-1,4-dioxine.
| Compound Name | 2,2,3,3,5,6-hexamethyl-1,4-dioxine |
|---|---|
| PubChem CID | 122631119 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2,2,3,3,5,6-hexamethyl-1,4-dioxine |
| SMILES | CC1=C(C)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H18O2/c1-7-8(2)12-10(5,6)9(3,4)11-7/h1-6H3 |
| InChIKey | NMSFTQAIVKHSKU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |