C20H31N5O3 — CID 143592024
ethyl 3-[4-[2-(2-oxohydrazinyl)anilino]piperidin-1-yl]azepane-1-carboxylate (PubChem CID 143592024) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethyl 3-[4-[2-(2-oxohydrazinyl)anilino]piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 3-[4-[2-(2-oxohydrazinyl)anilino]piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 143592024 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | ethyl 3-[4-[2-(2-oxohydrazinyl)anilino]piperidin-1-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCCC(N2CCC(Nc3ccccc3NN=O)CC2)C1 |
| InChI | InChI=1S/C20H31N5O3/c1-2-28-20(26)25-12-6-5-7-17(15-25)24-13-10-16(11-14-24)21-18-8-3-4-9-19(18)22-23-27/h3-4,8-9,16-17,21H,2,5-7,10-15H2,1H3,(H,22,27) |
| InChIKey | IRQMPBJLPMTGTE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|