C26H36N2O4 — CID 143593317
[2-[4-[di(propan-2-yl)amino]-1-hydroxy-2-phenylbutyl]phenyl] 2-acetamidoacetate (PubChem CID 143593317) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is [2-[4-[di(propan-2-yl)amino]-1-hydroxy-2-phenylbutyl]phenyl] 2-acetamidoacetate.
| Compound Name | [2-[4-[di(propan-2-yl)amino]-1-hydroxy-2-phenylbutyl]phenyl] 2-acetamidoacetate |
|---|---|
| PubChem CID | 143593317 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | [2-[4-[di(propan-2-yl)amino]-1-hydroxy-2-phenylbutyl]phenyl] 2-acetamidoacetate |
| SMILES | CC(=O)NCC(=O)Oc1ccccc1C(O)C(CCN(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H36N2O4/c1-18(2)28(19(3)4)16-15-22(21-11-7-6-8-12-21)26(31)23-13-9-10-14-24(23)32-25(30)17-27-20(5)29/h6-14,18-19,22,26,31H,15-17H2,1-5H3,(H,27,29) |
| InChIKey | RKOVBEDRKSXJCA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|