C15H25NO4S — CID 143594724
ethane;methyl 8-(2-methanimidoylsulfanylethenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 143594724) has the molecular formula C15H25NO4S and a molecular weight of 315.43 g/mol. Its IUPAC name is ethane;methyl 8-(2-methanimidoylsulfanylethenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethane;methyl 8-(2-methanimidoylsulfanylethenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 143594724 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | ethane;methyl 8-(2-methanimidoylsulfanylethenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CC.[H]/N=C/SC=CC1(C(=O)OC)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H19NO4S.C2H6/c1-16-11(15)12(6-9-19-10-14)2-4-13(5-3-12)17-7-8-18-13;1-2/h6,9-10,14H,2-5,7-8H2,1H3;1-2H3/b9-6?,14-10+; |
| InChIKey | RGGPSOQYTZAMMN-ASSXZYSRSA-N |
| XLogP | 3.34 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|