About methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate
methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate (PubChem CID 171991435) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate.
Analyze methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate?
The IUPAC name of methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate (CID 171991435) is methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate.
What is the SMILES notation for methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate?
The canonical SMILES for methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate is COC(=O)[C@@H]1CCC2(CCC3(CC2)OCCO3)O1.
What is the InChIKey of methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate?
The InChIKey is NQDGKQXXCYVOLN-JTQLQIEISA-N. The full InChI is InChI=1S/C13H20O5/c1-15-11(14)10-2-3-12(18-10)4-6-13(7-5-12)16-8-9-17-13/h10H,2-9H2,1H3/t10-/m0/s1.
What are the key properties of methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate?
methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate has a molecular weight of 256.30 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-4,9,12-trioxadispiro[4.2.48.25]tetradecane-3-carboxylate is sourced from PubChem (CID 171991435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).