C23H31N5O — CID 143595325
[4-(4-pentylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-phenylmethanone (PubChem CID 143595325) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is [4-(4-pentylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-phenylmethanone.
| Compound Name | [4-(4-pentylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-phenylmethanone |
|---|---|
| PubChem CID | 143595325 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | [4-(4-pentylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-phenylmethanone |
| SMILES | CCCCCN1CCN(c2ncnc3c2CCN(C(=O)c2ccccc2)C3)CC1 |
| InChI | InChI=1S/C23H31N5O/c1-2-3-7-11-26-13-15-27(16-14-26)22-20-10-12-28(17-21(20)24-18-25-22)23(29)19-8-5-4-6-9-19/h4-6,8-9,18H,2-3,7,10-17H2,1H3 |
| InChIKey | OKXZRSKGJIJUOZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|