C30H56N6O — CID 143595564
N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-N,2-dimethylbut-3-en-1-amine;methanol;N-pentylethanimine (PubChem CID 143595564) has the molecular formula C30H56N6O and a molecular weight of 516.82 g/mol. Its IUPAC name is N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-N,2-dimethylbut-3-en-1-amine;methanol;N-pentylethanimine.
| Compound Name | N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-N,2-dimethylbut-3-en-1-amine;methanol;N-pentylethanimine |
|---|---|
| PubChem CID | 143595564 |
| Molecular Formula | C30H56N6O |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.45 |
| IUPAC Name | N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-N,2-dimethylbut-3-en-1-amine;methanol;N-pentylethanimine |
| SMILES | C/C=N/CCCCC.C=CC(C)CN(C)CCc1nc(N2CCN(C3CCC3)CC2)ncc1CC.CO |
| InChI | InChI=1S/C22H37N5.C7H15N.CH4O/c1-5-18(3)17-25(4)11-10-21-19(6-2)16-23-22(24-21)27-14-12-26(13-15-27)20-8-7-9-20;1-3-5-6-7-8-4-2;1-2/h5,16,18,20H,1,6-15,17H2,2-4H3;4H,3,5-7H2,1-2H3;2H,1H3/b;8-4+; |
| InChIKey | JPSCFORLKHGCTC-UCBLOGBOSA-N |
| XLogP | 4.89 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|