C23H37N5 — CID 143595567
(4Z)-N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-4-methylhexa-1,4-dien-2-amine (PubChem CID 143595567) has the molecular formula C23H37N5 and a molecular weight of 383.58 g/mol. Its IUPAC name is (4Z)-N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-4-methylhexa-1,4-dien-2-amine.
| Compound Name | (4Z)-N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-4-methylhexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 143595567 |
| Molecular Formula | C23H37N5 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | (4Z)-N-[2-[2-(4-cyclobutylpiperazin-1-yl)-5-ethylpyrimidin-4-yl]ethyl]-4-methylhexa-1,4-dien-2-amine |
| SMILES | C=C(C/C(C)=C\C)NCCc1nc(N2CCN(C3CCC3)CC2)ncc1CC |
| InChI | InChI=1S/C23H37N5/c1-5-18(3)16-19(4)24-11-10-22-20(6-2)17-25-23(26-22)28-14-12-27(13-15-28)21-8-7-9-21/h5,17,21,24H,4,6-16H2,1-3H3/b18-5- |
| InChIKey | JSSXRZCRLBZURW-DVZOWYKESA-N |
| XLogP | 3.72 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|