C12H13N3O2 — CID 143596523
4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide (PubChem CID 143596523) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143596523 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide |
| SMILES | C=C/C=C(\C=C)n1ccnc(C(=O)NC)c1=O |
| InChI | InChI=1S/C12H13N3O2/c1-4-6-9(5-2)15-8-7-14-10(12(15)17)11(16)13-3/h4-8H,1-2H2,3H3,(H,13,16)/b9-6+ |
| InChIKey | PKQQHENGYINPGF-RMKNXTFCSA-N |
| XLogP | 0.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|