C17H12Cl4N2O — CID 143596743
3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,5-dihydropyrazole-5-carbonyl chloride (PubChem CID 143596743) has the molecular formula C17H12Cl4N2O and a molecular weight of 402.11 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,5-dihydropyrazole-5-carbonyl chloride.
| Compound Name | 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,5-dihydropyrazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 143596743 |
| Molecular Formula | C17H12Cl4N2O |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,5-dihydropyrazole-5-carbonyl chloride |
| SMILES | CC1=C(c2ccc(Cl)cc2)N(c2ccc(Cl)cc2Cl)NC1C(=O)Cl |
| InChI | InChI=1S/C17H12Cl4N2O/c1-9-15(17(21)24)22-23(14-7-6-12(19)8-13(14)20)16(9)10-2-4-11(18)5-3-10/h2-8,15,22H,1H3 |
| InChIKey | PMSCCAKMQWMEFQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|