C16H14N4S — CID 143597625
N-(pyridin-4-ylmethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine (PubChem CID 143597625) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine.
| Compound Name | N-(pyridin-4-ylmethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine |
|---|---|
| PubChem CID | 143597625 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine |
| SMILES | c1cc(CNc2ncnc3ccc4c(c23)CCS4)ccn1 |
| InChI | InChI=1S/C16H14N4S/c1-2-14-12(5-8-21-14)15-13(1)19-10-20-16(15)18-9-11-3-6-17-7-4-11/h1-4,6-7,10H,5,8-9H2,(H,18,19,20) |
| InChIKey | BZRIYYGSZXBDKC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |