C16H13N3OS — CID 143597708
2-(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)phenol (PubChem CID 143597708) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)phenol.
| Compound Name | 2-(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)phenol |
|---|---|
| PubChem CID | 143597708 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)phenol |
| SMILES | Oc1ccccc1Nc1ncnc2ccc3c(c12)CCS3 |
| InChI | InChI=1S/C16H13N3OS/c20-13-4-2-1-3-11(13)19-16-15-10-7-8-21-14(10)6-5-12(15)17-9-18-16/h1-6,9,20H,7-8H2,(H,17,18,19) |
| InChIKey | XLVJVRUKNSQJDR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|