C17H15N3OS — CID 143597622
3-[(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)methyl]phenol (PubChem CID 143597622) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)methyl]phenol.
| Compound Name | 3-[(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 143597622 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-[(8,9-dihydrothieno[3,2-f]quinazolin-1-ylamino)methyl]phenol |
| SMILES | Oc1cccc(CNc2ncnc3ccc4c(c23)CCS4)c1 |
| InChI | InChI=1S/C17H15N3OS/c21-12-3-1-2-11(8-12)9-18-17-16-13-6-7-22-15(13)5-4-14(16)19-10-20-17/h1-5,8,10,21H,6-7,9H2,(H,18,19,20) |
| InChIKey | AXCJTRBTLDWVHL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |