C16H13N3O3S — CID 59345061
2-[(7,7-dioxo-8,9-dihydrothieno[3,2-f]quinazolin-1-yl)amino]phenol (PubChem CID 59345061) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-[(7,7-dioxo-8,9-dihydrothieno[3,2-f]quinazolin-1-yl)amino]phenol.
| Compound Name | 2-[(7,7-dioxo-8,9-dihydrothieno[3,2-f]quinazolin-1-yl)amino]phenol |
|---|---|
| PubChem CID | 59345061 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[(7,7-dioxo-8,9-dihydrothieno[3,2-f]quinazolin-1-yl)amino]phenol |
| SMILES | O=S1(=O)CCc2c1ccc1ncnc(Nc3ccccc3O)c21 |
| InChI | InChI=1S/C16H13N3O3S/c20-13-4-2-1-3-11(13)19-16-15-10-7-8-23(21,22)14(10)6-5-12(15)17-9-18-16/h1-6,9,20H,7-8H2,(H,17,18,19) |
| InChIKey | NUELTCIHSZIMHP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|