C22H24BrClN8O3 — CID 143600119
8-bromo-1-[3-[5-(2-chloro-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]propanimidoyl]-2-imino-3-pentyl-7H-purin-6-one (PubChem CID 143600119) has the molecular formula C22H24BrClN8O3 and a molecular weight of 563.84 g/mol. Its IUPAC name is 8-bromo-1-[3-[5-(2-chloro-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]propanimidoyl]-2-imino-3-pentyl-7H-purin-6-one.
| Compound Name | 8-bromo-1-[3-[5-(2-chloro-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]propanimidoyl]-2-imino-3-pentyl-7H-purin-6-one |
|---|---|
| PubChem CID | 143600119 |
| Molecular Formula | C22H24BrClN8O3 |
| Molecular Weight | 563.84 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 8-bromo-1-[3-[5-(2-chloro-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]propanimidoyl]-2-imino-3-pentyl-7H-purin-6-one |
| SMILES | [H]/N=C(\CCc1noc(-c2ccc(OC)cc2Cl)n1)n1c(=O)c2[nH]c(Br)nc2n(CCCCC)/c1=N\[H] |
| InChI | InChI=1S/C22H24BrClN8O3/c1-3-4-5-10-31-18-17(28-21(23)29-18)20(33)32(22(31)26)15(25)8-9-16-27-19(35-30-16)13-7-6-12(34-2)11-14(13)24/h6-7,11,25-26H,3-5,8-10H2,1-2H3,(H,28,29)/b25-15+,26-22+ |
| InChIKey | BYQICRNXUWAAHI-DEAJYORDSA-N |
| XLogP | 4.13 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|