C25H34O3 — CID 143600411
(5S)-14',20'-dimethylspiro[oxolane-5,15'-pentacyclo[9.9.0.02,4.05,10.017,19]icos-5-ene]-2,7'-dione (PubChem CID 143600411) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (5S)-14',20'-dimethylspiro[oxolane-5,15'-pentacyclo[9.9.0.02,4.05,10.017,19]icos-5-ene]-2,7'-dione.
| Compound Name | (5S)-14',20'-dimethylspiro[oxolane-5,15'-pentacyclo[9.9.0.02,4.05,10.017,19]icos-5-ene]-2,7'-dione |
|---|---|
| PubChem CID | 143600411 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (5S)-14',20'-dimethylspiro[oxolane-5,15'-pentacyclo[9.9.0.02,4.05,10.017,19]icos-5-ene]-2,7'-dione |
| SMILES | CC1C2CC2C[C@@]2(CCC(=O)O2)C(C)CCC2C3CCC(=O)C=C3C3CC3C12 |
| InChI | InChI=1S/C25H34O3/c1-13-3-5-18-17-6-4-16(26)10-20(17)21-11-22(21)24(18)14(2)19-9-15(19)12-25(13)8-7-23(27)28-25/h10,13-15,17-19,21-22,24H,3-9,11-12H2,1-2H3/t13?,14?,15?,17?,18?,19?,21?,22?,24?,25-/m0/s1 |
| InChIKey | NTOOREXLQCQASA-XVDNOGQLSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |