C22H30O2 — CID 70827910
(2R,10'R,14'S)-14'-methylspiro[oxolane-2,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-7'-one (PubChem CID 70827910) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2R,10'R,14'S)-14'-methylspiro[oxolane-2,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-7'-one.
| Compound Name | (2R,10'R,14'S)-14'-methylspiro[oxolane-2,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-7'-one |
|---|---|
| PubChem CID | 70827910 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2R,10'R,14'S)-14'-methylspiro[oxolane-2,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-7'-one |
| SMILES | C[C@]12CCC3C(C4CC4C4=CC(=O)CC[C@@H]43)C1CC[C@@]21CCCO1 |
| InChI | InChI=1S/C22H30O2/c1-21-8-5-15-14-4-3-13(23)11-16(14)17-12-18(17)20(15)19(21)6-9-22(21)7-2-10-24-22/h11,14-15,17-20H,2-10,12H2,1H3/t14-,15?,17?,18?,19?,20?,21+,22+/m1/s1 |
| InChIKey | JSXHPOPDBLVMCL-FAPDOSNVSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |