C10H9FN2O2S — CID 143603151
ethyl N-[6-fluoro-3-(2-sulfanylethynyl)-2-pyridinyl]carbamate (PubChem CID 143603151) has the molecular formula C10H9FN2O2S and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl N-[6-fluoro-3-(2-sulfanylethynyl)-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-fluoro-3-(2-sulfanylethynyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 143603151 |
| Molecular Formula | C10H9FN2O2S |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | ethyl N-[6-fluoro-3-(2-sulfanylethynyl)-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1nc(F)ccc1C#CS |
| InChI | InChI=1S/C10H9FN2O2S/c1-2-15-10(14)13-9-7(5-6-16)3-4-8(11)12-9/h3-4,16H,2H2,1H3,(H,12,13,14) |
| InChIKey | BEJGDPHZYXFBSB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|