C27H34N2O7 — CID 143603300
2-[[1-[[4-(4-hydroxybutoxy)phenyl]methoxycarbonyl]piperidine-4-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 143603300) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[[1-[[4-(4-hydroxybutoxy)phenyl]methoxycarbonyl]piperidine-4-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[1-[[4-(4-hydroxybutoxy)phenyl]methoxycarbonyl]piperidine-4-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 143603300 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-[[1-[[4-(4-hydroxybutoxy)phenyl]methoxycarbonyl]piperidine-4-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)C1CCN(C(=O)OCc2ccc(OCCCCO)cc2)CC1 |
| InChI | InChI=1S/C27H34N2O7/c30-16-4-5-17-35-23-10-8-21(9-11-23)19-36-27(34)29-14-12-22(13-15-29)25(31)28-24(26(32)33)18-20-6-2-1-3-7-20/h1-3,6-11,22,24,30H,4-5,12-19H2,(H,28,31)(H,32,33) |
| InChIKey | KXNAPVWLJWITCM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|