C17H19F3N2O3 — CID 143603988
methyl 2-prop-2-enyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 143603988) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is methyl 2-prop-2-enyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | methyl 2-prop-2-enyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 143603988 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl 2-prop-2-enyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | C=CCC1C(C(=O)OC)CCCN1C(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N2O3/c1-3-5-14-11(16(24)25-2)6-4-9-22(14)15(23)12-10-21-8-7-13(12)17(18,19)20/h3,7-8,10-11,14H,1,4-6,9H2,2H3 |
| InChIKey | BIDVTHIHFBJMBU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|