C19H22F3N7OS — CID 143604311
5-N-(3-morpholin-4-ylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine (PubChem CID 143604311) has the molecular formula C19H22F3N7OS and a molecular weight of 453.49 g/mol. Its IUPAC name is 5-N-(3-morpholin-4-ylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine.
| Compound Name | 5-N-(3-morpholin-4-ylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
|---|---|
| PubChem CID | 143604311 |
| Molecular Formula | C19H22F3N7OS |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 5-N-(3-morpholin-4-ylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
| SMILES | Nc1nc2c(Nc3ccc(C(F)(F)F)cc3)nc(NCCCN3CCOCC3)nc2s1 |
| InChI | InChI=1S/C19H22F3N7OS/c20-19(21,22)12-2-4-13(5-3-12)25-15-14-16(31-17(23)26-14)28-18(27-15)24-6-1-7-29-8-10-30-11-9-29/h2-5H,1,6-11H2,(H2,23,26)(H2,24,25,27,28) |
| InChIKey | GLBAEIODXYPCQZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|