C12H23N3O2 — CID 143608775
ethane;1-(2-methoxyethyl)-3-(2-methyl-3,4-dihydropyridin-6-yl)urea (PubChem CID 143608775) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is ethane;1-(2-methoxyethyl)-3-(2-methyl-3,4-dihydropyridin-6-yl)urea.
| Compound Name | ethane;1-(2-methoxyethyl)-3-(2-methyl-3,4-dihydropyridin-6-yl)urea |
|---|---|
| PubChem CID | 143608775 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | ethane;1-(2-methoxyethyl)-3-(2-methyl-3,4-dihydropyridin-6-yl)urea |
| SMILES | CC.COCCNC(=O)NC1=CCCC(C)=N1 |
| InChI | InChI=1S/C10H17N3O2.C2H6/c1-8-4-3-5-9(12-8)13-10(14)11-6-7-15-2;1-2/h5H,3-4,6-7H2,1-2H3,(H2,11,13,14);1-2H3 |
| InChIKey | CBGTUFMATSNHLS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|