C11H19NO — CID 143610730
ethane;3-methyl-3,4,7,8-tetrahydro-2H-1,4-benzoxazine (PubChem CID 143610730) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;3-methyl-3,4,7,8-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | ethane;3-methyl-3,4,7,8-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 143610730 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethane;3-methyl-3,4,7,8-tetrahydro-2H-1,4-benzoxazine |
| SMILES | CC.CC1COC2=C(C=CCC2)N1 |
| InChI | InChI=1S/C9H13NO.C2H6/c1-7-6-11-9-5-3-2-4-8(9)10-7;1-2/h2,4,7,10H,3,5-6H2,1H3;1-2H3 |
| InChIKey | UEUNLNGPXNFDPU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |