C40H46N2O4 — CID 143610924
4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-[methyl(propyl)amino]phenyl]ethenyl]phenyl]ethenyl]aniline;1-(4-methylphenyl)-2-prop-1-en-2-yloxyethanone (PubChem CID 143610924) has the molecular formula C40H46N2O4 and a molecular weight of 618.82 g/mol. Its IUPAC name is 4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-[methyl(propyl)amino]phenyl]ethenyl]phenyl]ethenyl]aniline;1-(4-methylphenyl)-2-prop-1-en-2-yloxyethanone.
| Compound Name | 4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-[methyl(propyl)amino]phenyl]ethenyl]phenyl]ethenyl]aniline;1-(4-methylphenyl)-2-prop-1-en-2-yloxyethanone |
|---|---|
| PubChem CID | 143610924 |
| Molecular Formula | C40H46N2O4 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | 4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-[methyl(propyl)amino]phenyl]ethenyl]phenyl]ethenyl]aniline;1-(4-methylphenyl)-2-prop-1-en-2-yloxyethanone |
| SMILES | C=C(C)OCC(=O)c1ccc(C)cc1.CCCN(C)c1ccc(/C=C/c2cc(OC)c(/C=C/c3ccc(N)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C28H32N2O2.C12H14O2/c1-5-18-30(2)26-16-10-22(11-17-26)7-13-24-20-27(31-3)23(19-28(24)32-4)12-6-21-8-14-25(29)15-9-21;1-9(2)14-8-12(13)11-6-4-10(3)5-7-11/h6-17,19-20H,5,18,29H2,1-4H3;4-7H,1,8H2,2-3H3/b12-6+,13-7+; |
| InChIKey | DRBHUCBCQRFQNP-FSRDMIDLSA-N |
| XLogP | 9.20 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|