C20H22N2O2 — CID 143611834
4-[[4-[[[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]amino]methyl]phenyl]methylamino]phenol (PubChem CID 143611834) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[[4-[[[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]amino]methyl]phenyl]methylamino]phenol.
| Compound Name | 4-[[4-[[[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]amino]methyl]phenyl]methylamino]phenol |
|---|---|
| PubChem CID | 143611834 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-[[4-[[[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]amino]methyl]phenyl]methylamino]phenol |
| SMILES | C=C(O)/C=C\C(=C)NCc1ccc(CNc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-15(3-4-16(2)23)21-13-17-5-7-18(8-6-17)14-22-19-9-11-20(24)12-10-19/h3-12,21-24H,1-2,13-14H2/b4-3- |
| InChIKey | QPDBHTJZHRGKQH-ARJAWSKDSA-N |
| XLogP | 4.24 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OH_alk_A(8)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|